1-cyclohexylpyrazole-4-carbonyl chloride

C10H13ClN2O — CID 83814222

IUPAC1-cyclohexylpyrazole-4-carbonyl chloride
SMILESO=C(Cl)c1cnn(C2CCCCC2)c1
InChIInChI=1S/C10H13ClN2O/c11-10(14)8-6-12-13(7-8)9-4-2-1-3-5-9/h6-7,9H,1-5H2
InChIKeyJNFRIRZERPLQDG-UHFFFAOYSA-N
MW212.68 g/mol
LogP2.77
Rot. Bonds2

About 1-cyclohexylpyrazole-4-carbonyl chloride

1-cyclohexylpyrazole-4-carbonyl chloride (PubChem CID 83814222) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 1-cyclohexylpyrazole-4-carbonyl chloride.

Molecular Properties

Compound Name1-cyclohexylpyrazole-4-carbonyl chloride
PubChem CID83814222
Molecular FormulaC10H13ClN2O
Molecular Weight212.68 g/mol
Exact Mass212.07
IUPAC Name1-cyclohexylpyrazole-4-carbonyl chloride
SMILESO=C(Cl)c1cnn(C2CCCCC2)c1
InChIInChI=1S/C10H13ClN2O/c11-10(14)8-6-12-13(7-8)9-4-2-1-3-5-9/h6-7,9H,1-5H2
InChIKeyJNFRIRZERPLQDG-UHFFFAOYSA-N
XLogP2.77
TPSA34.89 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.68
LogP ≤ 52.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1-cyclohexylpyrazole-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-cyclohexylpyrazole-4-carbonyl chloride?
The IUPAC name of 1-cyclohexylpyrazole-4-carbonyl chloride (CID 83814222) is 1-cyclohexylpyrazole-4-carbonyl chloride.
What is the SMILES notation for 1-cyclohexylpyrazole-4-carbonyl chloride?
The canonical SMILES for 1-cyclohexylpyrazole-4-carbonyl chloride is O=C(Cl)c1cnn(C2CCCCC2)c1.
What is the InChIKey of 1-cyclohexylpyrazole-4-carbonyl chloride?
The InChIKey is JNFRIRZERPLQDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O/c11-10(14)8-6-12-13(7-8)9-4-2-1-3-5-9/h6-7,9H,1-5H2.
What are the key properties of 1-cyclohexylpyrazole-4-carbonyl chloride?
1-cyclohexylpyrazole-4-carbonyl chloride has a molecular weight of 212.68 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylpyrazole-4-carbonyl chloride is sourced from PubChem (CID 83814222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).