C19H37NO6 — CID 167464617
tert-butyl 3-[2-[2-[4-(2-aminoethoxy)cyclohexyl]oxyethoxy]ethoxy]propanoate (PubChem CID 167464617) has the molecular formula C19H37NO6 and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[4-(2-aminoethoxy)cyclohexyl]oxyethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[4-(2-aminoethoxy)cyclohexyl]oxyethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 167464617 |
| Molecular Formula | C19H37NO6 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | tert-butyl 3-[2-[2-[4-(2-aminoethoxy)cyclohexyl]oxyethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOC1CCC(OCCN)CC1 |
| InChI | InChI=1S/C19H37NO6/c1-19(2,3)26-18(21)8-10-22-12-13-23-14-15-25-17-6-4-16(5-7-17)24-11-9-20/h16-17H,4-15,20H2,1-3H3 |
| InChIKey | YPCIKUNIMLWTMG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|