C24H27N3O2 — CID 167465069
(2Z)-2-[2,3-bis(ethenyl)-1-ethyl-6-[(E)-prop-1-enyl]-4-pyridinylidene]-2-(4-nitrophenyl)acetonitrile;ethane (PubChem CID 167465069) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is (2Z)-2-[2,3-bis(ethenyl)-1-ethyl-6-[(E)-prop-1-enyl]-4-pyridinylidene]-2-(4-nitrophenyl)acetonitrile;ethane.
| Compound Name | (2Z)-2-[2,3-bis(ethenyl)-1-ethyl-6-[(E)-prop-1-enyl]-4-pyridinylidene]-2-(4-nitrophenyl)acetonitrile;ethane |
|---|---|
| PubChem CID | 167465069 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (2Z)-2-[2,3-bis(ethenyl)-1-ethyl-6-[(E)-prop-1-enyl]-4-pyridinylidene]-2-(4-nitrophenyl)acetonitrile;ethane |
| SMILES | C=CC1=C(C=C)N(CC)C(/C=C/C)=C/C1=C(/C#N)c1ccc([N+](=O)[O-])cc1.CC |
| InChI | InChI=1S/C22H21N3O2.C2H6/c1-5-9-18-14-20(19(6-2)22(7-3)24(18)8-4)21(15-23)16-10-12-17(13-11-16)25(26)27;1-2/h5-7,9-14H,2-3,8H2,1,4H3;1-2H3/b9-5+,21-20+; |
| InChIKey | ZMGXBIWKYXCIRI-WXDKLUSCSA-N |
| XLogP | 6.32 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|