C16H16N2O3S2 — CID 167466268
ethyl 2-[bis(thiophen-2-ylmethyl)amino]-1,3-oxazole-4-carboxylate (PubChem CID 167466268) has the molecular formula C16H16N2O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethyl 2-[bis(thiophen-2-ylmethyl)amino]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[bis(thiophen-2-ylmethyl)amino]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 167466268 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | ethyl 2-[bis(thiophen-2-ylmethyl)amino]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(N(Cc2cccs2)Cc2cccs2)n1 |
| InChI | InChI=1S/C16H16N2O3S2/c1-2-20-15(19)14-11-21-16(17-14)18(9-12-5-3-7-22-12)10-13-6-4-8-23-13/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | UBXYTQJSVWDKNE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |