C12H7F4NOS — CID 167466483
5-fluoro-3-methyl-2-(2,2,2-trifluoro-1-isothiocyanatoethyl)-1-benzofuran (PubChem CID 167466483) has the molecular formula C12H7F4NOS and a molecular weight of 289.25 g/mol. Its IUPAC name is 5-fluoro-3-methyl-2-(2,2,2-trifluoro-1-isothiocyanatoethyl)-1-benzofuran.
| Compound Name | 5-fluoro-3-methyl-2-(2,2,2-trifluoro-1-isothiocyanatoethyl)-1-benzofuran |
|---|---|
| PubChem CID | 167466483 |
| Molecular Formula | C12H7F4NOS |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 5-fluoro-3-methyl-2-(2,2,2-trifluoro-1-isothiocyanatoethyl)-1-benzofuran |
| SMILES | Cc1c(C(N=C=S)C(F)(F)F)oc2ccc(F)cc12 |
| InChI | InChI=1S/C12H7F4NOS/c1-6-8-4-7(13)2-3-9(8)18-10(6)11(17-5-19)12(14,15)16/h2-4,11H,1H3 |
| InChIKey | UGNICXIIMQKCGC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|