C11H17NO — CID 167466590
4-but-2-ynyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine (PubChem CID 167466590) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-but-2-ynyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine.
| Compound Name | 4-but-2-ynyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 167466590 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-but-2-ynyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine |
| SMILES | CC#CCN1CCCC2OCCC21 |
| InChI | InChI=1S/C11H17NO/c1-2-3-7-12-8-4-5-11-10(12)6-9-13-11/h10-11H,4-9H2,1H3 |
| InChIKey | VWRUHRQYTXEJRF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|