C33H36F5N7O — CID 167467326
3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-(trifluoromethyl)quinazolin-7-yl]-1,2-dimethylindol-5-amine (PubChem CID 167467326) has the molecular formula C33H36F5N7O and a molecular weight of 641.69 g/mol. Its IUPAC name is 3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-(trifluoromethyl)quinazolin-7-yl]-1,2-dimethylindol-5-amine.
| Compound Name | 3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-(trifluoromethyl)quinazolin-7-yl]-1,2-dimethylindol-5-amine |
|---|---|
| PubChem CID | 167467326 |
| Molecular Formula | C33H36F5N7O |
| Molecular Weight | 641.69 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | 3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-6-(trifluoromethyl)quinazolin-7-yl]-1,2-dimethylindol-5-amine |
| SMILES | Cc1c(-c2c(C(F)(F)F)cc3c(N4CC5CCC(C4)N5)nc(OC[C@@]45CCCN4C[C@H](F)C5)nc3c2F)c2cc(N)ccc2n1C |
| InChI | InChI=1S/C33H36F5N7O/c1-17-26(22-10-19(39)4-7-25(22)43(17)2)27-24(33(36,37)38)11-23-29(28(27)35)41-31(42-30(23)44-14-20-5-6-21(15-44)40-20)46-16-32-8-3-9-45(32)13-18(34)12-32/h4,7,10-11,18,20-21,40H,3,5-6,8-9,12-16,39H2,1-2H3/t18-,20?,21?,32+/m1/s1 |
| InChIKey | SWJAHQOOXRMZBG-IVBPMFBTSA-N |
| XLogP | 5.73 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|