C24H26ClN5O4 — CID 16746770
3-morpholin-4-ylpropyl N-[5-[[3-(3-chlorophenyl)-6-oxopyridazin-1-yl]methyl]-2-pyridinyl]carbamate (PubChem CID 16746770) has the molecular formula C24H26ClN5O4 and a molecular weight of 483.96 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl N-[5-[[3-(3-chlorophenyl)-6-oxopyridazin-1-yl]methyl]-2-pyridinyl]carbamate.
| Compound Name | 3-morpholin-4-ylpropyl N-[5-[[3-(3-chlorophenyl)-6-oxopyridazin-1-yl]methyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 16746770 |
| Molecular Formula | C24H26ClN5O4 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 3-morpholin-4-ylpropyl N-[5-[[3-(3-chlorophenyl)-6-oxopyridazin-1-yl]methyl]-2-pyridinyl]carbamate |
| SMILES | O=C(Nc1ccc(Cn2nc(-c3cccc(Cl)c3)ccc2=O)cn1)OCCCN1CCOCC1 |
| InChI | InChI=1S/C24H26ClN5O4/c25-20-4-1-3-19(15-20)21-6-8-23(31)30(28-21)17-18-5-7-22(26-16-18)27-24(32)34-12-2-9-29-10-13-33-14-11-29/h1,3-8,15-16H,2,9-14,17H2,(H,26,27,32) |
| InChIKey | SFRPQVMFSVIXIZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|