C25H25F3N4O3 — CID 59849672
3-pyrrolidin-1-ylpropyl N-[3-[[6-oxo-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamate (PubChem CID 59849672) has the molecular formula C25H25F3N4O3 and a molecular weight of 486.49 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl N-[3-[[6-oxo-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamate.
| Compound Name | 3-pyrrolidin-1-ylpropyl N-[3-[[6-oxo-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 59849672 |
| Molecular Formula | C25H25F3N4O3 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl N-[3-[[6-oxo-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamate |
| SMILES | O=C(Nc1cccc(Cn2nc(-c3cc(F)c(F)c(F)c3)ccc2=O)c1)OCCCN1CCCC1 |
| InChI | InChI=1S/C25H25F3N4O3/c26-20-14-18(15-21(27)24(20)28)22-7-8-23(33)32(30-22)16-17-5-3-6-19(13-17)29-25(34)35-12-4-11-31-9-1-2-10-31/h3,5-8,13-15H,1-2,4,9-12,16H2,(H,29,34) |
| InChIKey | QVFOWVMKCKWSBG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|