C24H25F2N3O5 — CID 25127595
ethyl N-[3-[[3-[3,5-difluoro-4-(4-hydroxybutoxy)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate (PubChem CID 25127595) has the molecular formula C24H25F2N3O5 and a molecular weight of 473.48 g/mol. Its IUPAC name is ethyl N-[3-[[3-[3,5-difluoro-4-(4-hydroxybutoxy)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[3-[3,5-difluoro-4-(4-hydroxybutoxy)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 25127595 |
| Molecular Formula | C24H25F2N3O5 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | ethyl N-[3-[[3-[3,5-difluoro-4-(4-hydroxybutoxy)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(Cn2nc(-c3cc(F)c(OCCCCO)c(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C24H25F2N3O5/c1-2-33-24(32)27-18-7-5-6-16(12-18)15-29-22(31)9-8-21(28-29)17-13-19(25)23(20(26)14-17)34-11-4-3-10-30/h5-9,12-14,30H,2-4,10-11,15H2,1H3,(H,27,32) |
| InChIKey | OFYDOQOWBMXJBG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|