C21H18N4O3 — CID 59406745
ethyl N-[3-[[3-(4-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate (PubChem CID 59406745) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl N-[3-[[3-(4-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[3-(4-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 59406745 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | ethyl N-[3-[[3-(4-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(Cn2nc(-c3ccc(C#N)cc3)ccc2=O)c1 |
| InChI | InChI=1S/C21H18N4O3/c1-2-28-21(27)23-18-5-3-4-16(12-18)14-25-20(26)11-10-19(24-25)17-8-6-15(13-22)7-9-17/h3-12H,2,14H2,1H3,(H,23,27) |
| InChIKey | XIRPRHFCFCIROB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |