C21H21N3O4 — CID 25121651
ethyl N-[3-[[3-[4-(hydroxymethyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate (PubChem CID 25121651) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is ethyl N-[3-[[3-[4-(hydroxymethyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[3-[4-(hydroxymethyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 25121651 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | ethyl N-[3-[[3-[4-(hydroxymethyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(Cn2nc(-c3ccc(CO)cc3)ccc2=O)c1 |
| InChI | InChI=1S/C21H21N3O4/c1-2-28-21(27)22-18-5-3-4-16(12-18)13-24-20(26)11-10-19(23-24)17-8-6-15(14-25)7-9-17/h3-12,25H,2,13-14H2,1H3,(H,22,27) |
| InChIKey | VAHXWSVKGSYXST-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |