C26H30N4O5 — CID 59406656
ethyl N-[3-[[3-[3-[2-(4-hydroxybutylamino)-2-oxoethyl]phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate (PubChem CID 59406656) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is ethyl N-[3-[[3-[3-[2-(4-hydroxybutylamino)-2-oxoethyl]phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[3-[3-[2-(4-hydroxybutylamino)-2-oxoethyl]phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 59406656 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | ethyl N-[3-[[3-[3-[2-(4-hydroxybutylamino)-2-oxoethyl]phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(Cn2nc(-c3cccc(CC(=O)NCCCCO)c3)ccc2=O)c1 |
| InChI | InChI=1S/C26H30N4O5/c1-2-35-26(34)28-22-10-6-8-20(16-22)18-30-25(33)12-11-23(29-30)21-9-5-7-19(15-21)17-24(32)27-13-3-4-14-31/h5-12,15-16,31H,2-4,13-14,17-18H2,1H3,(H,27,32)(H,28,34) |
| InChIKey | SHYHTJBUFHMMDV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|