C25H28N4O5 — CID 59406774
ethyl N-[3-[[3-[4-(4-hydroxybutylcarbamoyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate (PubChem CID 59406774) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is ethyl N-[3-[[3-[4-(4-hydroxybutylcarbamoyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[3-[4-(4-hydroxybutylcarbamoyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 59406774 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | ethyl N-[3-[[3-[4-(4-hydroxybutylcarbamoyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(Cn2nc(-c3ccc(C(=O)NCCCCO)cc3)ccc2=O)c1 |
| InChI | InChI=1S/C25H28N4O5/c1-2-34-25(33)27-21-7-5-6-18(16-21)17-29-23(31)13-12-22(28-29)19-8-10-20(11-9-19)24(32)26-14-3-4-15-30/h5-13,16,30H,2-4,14-15,17H2,1H3,(H,26,32)(H,27,33) |
| InChIKey | DJVRWTPOFJZHPN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|