C28H33N3O4 — CID 160922728
ethyl 2-[3-[[3-[4-(4-methylpentylcarbamoyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]acetate (PubChem CID 160922728) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is ethyl 2-[3-[[3-[4-(4-methylpentylcarbamoyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]acetate.
| Compound Name | ethyl 2-[3-[[3-[4-(4-methylpentylcarbamoyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 160922728 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | ethyl 2-[3-[[3-[4-(4-methylpentylcarbamoyl)phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(Cn2nc(-c3ccc(C(=O)NCCCC(C)C)cc3)ccc2=O)c1 |
| InChI | InChI=1S/C28H33N3O4/c1-4-35-27(33)18-21-8-5-9-22(17-21)19-31-26(32)15-14-25(30-31)23-10-12-24(13-11-23)28(34)29-16-6-7-20(2)3/h5,8-15,17,20H,4,6-7,16,18-19H2,1-3H3,(H,29,34) |
| InChIKey | SSFYNFNCGMOBOB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|