C24H26FN3O3 — CID 158499857
3-(dimethylamino)propyl 2-[3-[[3-(3-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]acetate (PubChem CID 158499857) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2-[3-[[3-(3-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]acetate.
| Compound Name | 3-(dimethylamino)propyl 2-[3-[[3-(3-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 158499857 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 3-(dimethylamino)propyl 2-[3-[[3-(3-fluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]acetate |
| SMILES | CN(C)CCCOC(=O)Cc1cccc(Cn2nc(-c3cccc(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C24H26FN3O3/c1-27(2)12-5-13-31-24(30)15-18-6-3-7-19(14-18)17-28-23(29)11-10-22(26-28)20-8-4-9-21(25)16-20/h3-4,6-11,14,16H,5,12-13,15,17H2,1-2H3 |
| InChIKey | HJTIBWUKPOPRHC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|