About 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate
3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate (PubChem CID 159652887) has the molecular formula C21H24N4O3S
and a molecular weight of 412.52 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate |
| PubChem CID | 159652887 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate |
| SMILES | CN(C)CCCOC(=O)Cc1cccc(Cn2nc(-c3nccs3)ccc2=O)c1 |
| InChI | InChI=1S/C21H24N4O3S/c1-24(2)10-4-11-28-20(27)14-16-5-3-6-17(13-16)15-25-19(26)8-7-18(23-25)21-22-9-12-29-21/h3,5-9,12-13H,4,10-11,14-15H2,1-2H3 |
| InChIKey | MRULETUOPWGOPI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate?
The IUPAC name of 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate (CID 159652887) is 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate.
What is the SMILES notation for 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate?
The canonical SMILES for 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate is CN(C)CCCOC(=O)Cc1cccc(Cn2nc(-c3nccs3)ccc2=O)c1.
What is the InChIKey of 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate?
The InChIKey is MRULETUOPWGOPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O3S/c1-24(2)10-4-11-28-20(27)14-16-5-3-6-17(13-16)15-25-19(26)8-7-18(23-25)21-22-9-12-29-21/h3,5-9,12-13H,4,10-11,14-15H2,1-2H3.
What are the key properties of 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate?
3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate has a molecular weight of 412.52 g/mol, XLogP of 2.45, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 2-[3-[[6-oxo-3-(1,3-thiazol-2-yl)pyridazin-1-yl]methyl]phenyl]acetate is sourced from PubChem (CID 159652887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).