C23H23F3N4O3 — CID 67419621
3-(dimethylamino)propyl-[3-[[6-oxo-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamic acid (PubChem CID 67419621) has the molecular formula C23H23F3N4O3 and a molecular weight of 460.46 g/mol. Its IUPAC name is 3-(dimethylamino)propyl-[3-[[6-oxo-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamic acid.
| Compound Name | 3-(dimethylamino)propyl-[3-[[6-oxo-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 67419621 |
| Molecular Formula | C23H23F3N4O3 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 3-(dimethylamino)propyl-[3-[[6-oxo-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamic acid |
| SMILES | CN(C)CCCN(C(=O)O)c1cccc(Cn2nc(-c3cc(F)c(F)c(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C23H23F3N4O3/c1-28(2)9-4-10-29(23(32)33)17-6-3-5-15(11-17)14-30-21(31)8-7-20(27-30)16-12-18(24)22(26)19(25)13-16/h3,5-8,11-13H,4,9-10,14H2,1-2H3,(H,32,33) |
| InChIKey | HIBZAAPEFMBNSM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|