C24H27FN4O3 — CID 143480984
[3-[[3-(3-fluoro-5-methylphenyl)-6-oxopyridazin-1-yl]methyl]phenyl] N-[3-(dimethylamino)propyl]carbamate (PubChem CID 143480984) has the molecular formula C24H27FN4O3 and a molecular weight of 438.50 g/mol. Its IUPAC name is [3-[[3-(3-fluoro-5-methylphenyl)-6-oxopyridazin-1-yl]methyl]phenyl] N-[3-(dimethylamino)propyl]carbamate.
| Compound Name | [3-[[3-(3-fluoro-5-methylphenyl)-6-oxopyridazin-1-yl]methyl]phenyl] N-[3-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 143480984 |
| Molecular Formula | C24H27FN4O3 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | [3-[[3-(3-fluoro-5-methylphenyl)-6-oxopyridazin-1-yl]methyl]phenyl] N-[3-(dimethylamino)propyl]carbamate |
| SMILES | Cc1cc(F)cc(-c2ccc(=O)n(Cc3cccc(OC(=O)NCCCN(C)C)c3)n2)c1 |
| InChI | InChI=1S/C24H27FN4O3/c1-17-12-19(15-20(25)13-17)22-8-9-23(30)29(27-22)16-18-6-4-7-21(14-18)32-24(31)26-10-5-11-28(2)3/h4,6-9,12-15H,5,10-11,16H2,1-3H3,(H,26,31) |
| InChIKey | KFYWUHASMNUVHV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|