C23H24F2N4O3 — CID 67492171
3-(dimethylamino)propyl N-[3-[[3-(2,4-difluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate (PubChem CID 67492171) has the molecular formula C23H24F2N4O3 and a molecular weight of 442.47 g/mol. Its IUPAC name is 3-(dimethylamino)propyl N-[3-[[3-(2,4-difluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate.
| Compound Name | 3-(dimethylamino)propyl N-[3-[[3-(2,4-difluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67492171 |
| Molecular Formula | C23H24F2N4O3 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-(dimethylamino)propyl N-[3-[[3-(2,4-difluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
| SMILES | CN(C)CCCOC(=O)Nc1cccc(Cn2nc(-c3ccc(F)cc3F)ccc2=O)c1 |
| InChI | InChI=1S/C23H24F2N4O3/c1-28(2)11-4-12-32-23(31)26-18-6-3-5-16(13-18)15-29-22(30)10-9-21(27-29)19-8-7-17(24)14-20(19)25/h3,5-10,13-14H,4,11-12,15H2,1-2H3,(H,26,31) |
| InChIKey | LUXQGVCIWQKTBX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|