C22H25FN4O3S — CID 16734733
3-(dimethylamino)propyl N-[3-[[5-(3-fluorophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]carbamate (PubChem CID 16734733) has the molecular formula C22H25FN4O3S and a molecular weight of 444.53 g/mol. Its IUPAC name is 3-(dimethylamino)propyl N-[3-[[5-(3-fluorophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]carbamate.
| Compound Name | 3-(dimethylamino)propyl N-[3-[[5-(3-fluorophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 16734733 |
| Molecular Formula | C22H25FN4O3S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 3-(dimethylamino)propyl N-[3-[[5-(3-fluorophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]carbamate |
| SMILES | CN(C)CCCOC(=O)Nc1cccc(CN2N=C(c3cccc(F)c3)CSC2=O)c1 |
| InChI | InChI=1S/C22H25FN4O3S/c1-26(2)10-5-11-30-21(28)24-19-9-3-6-16(12-19)14-27-22(29)31-15-20(25-27)17-7-4-8-18(23)13-17/h3-4,6-9,12-13H,5,10-11,14-15H2,1-2H3,(H,24,28) |
| InChIKey | IGMIDUSFWCIVJL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|