C22H21ClN4O6S — CID 174570325
N'-[3-[[5-(4-chlorophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]oxamide;3-oxobutanoic acid (PubChem CID 174570325) has the molecular formula C22H21ClN4O6S and a molecular weight of 504.95 g/mol. Its IUPAC name is N'-[3-[[5-(4-chlorophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]oxamide;3-oxobutanoic acid.
| Compound Name | N'-[3-[[5-(4-chlorophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]oxamide;3-oxobutanoic acid |
|---|---|
| PubChem CID | 174570325 |
| Molecular Formula | C22H21ClN4O6S |
| Molecular Weight | 504.95 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | N'-[3-[[5-(4-chlorophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]oxamide;3-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)O.NC(=O)C(=O)Nc1cccc(CN2N=C(c3ccc(Cl)cc3)CSC2=O)c1 |
| InChI | InChI=1S/C18H15ClN4O3S.C4H6O3/c19-13-6-4-12(5-7-13)15-10-27-18(26)23(22-15)9-11-2-1-3-14(8-11)21-17(25)16(20)24;1-3(5)2-4(6)7/h1-8H,9-10H2,(H2,20,24)(H,21,25);2H2,1H3,(H,6,7) |
| InChIKey | WFXWNQAKWZKKCW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.95 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|