C21H21N5O3S — CID 16734479
2-(methylamino)ethyl N-[3-[[5-(4-cyanophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]carbamate (PubChem CID 16734479) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is 2-(methylamino)ethyl N-[3-[[5-(4-cyanophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]carbamate.
| Compound Name | 2-(methylamino)ethyl N-[3-[[5-(4-cyanophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 16734479 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-(methylamino)ethyl N-[3-[[5-(4-cyanophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]carbamate |
| SMILES | CNCCOC(=O)Nc1cccc(CN2N=C(c3ccc(C#N)cc3)CSC2=O)c1 |
| InChI | InChI=1S/C21H21N5O3S/c1-23-9-10-29-20(27)24-18-4-2-3-16(11-18)13-26-21(28)30-14-19(25-26)17-7-5-15(12-22)6-8-17/h2-8,11,23H,9-10,13-14H2,1H3,(H,24,27) |
| InChIKey | QTHKFYYSEWJJHJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|