C25H33N5O3S — CID 89362571
3-(propan-2-ylamino)propyl N-[3-[1-[5-(4-aminophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]propyl]phenyl]carbamate (PubChem CID 89362571) has the molecular formula C25H33N5O3S and a molecular weight of 483.64 g/mol. Its IUPAC name is 3-(propan-2-ylamino)propyl N-[3-[1-[5-(4-aminophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]propyl]phenyl]carbamate.
| Compound Name | 3-(propan-2-ylamino)propyl N-[3-[1-[5-(4-aminophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]propyl]phenyl]carbamate |
|---|---|
| PubChem CID | 89362571 |
| Molecular Formula | C25H33N5O3S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 3-(propan-2-ylamino)propyl N-[3-[1-[5-(4-aminophenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]propyl]phenyl]carbamate |
| SMILES | CCC(c1cccc(NC(=O)OCCCNC(C)C)c1)N1N=C(c2ccc(N)cc2)CSC1=O |
| InChI | InChI=1S/C25H33N5O3S/c1-4-23(30-25(32)34-16-22(29-30)18-9-11-20(26)12-10-18)19-7-5-8-21(15-19)28-24(31)33-14-6-13-27-17(2)3/h5,7-12,15,17,23,27H,4,6,13-14,16,26H2,1-3H3,(H,28,31) |
| InChIKey | HJOTVUVYFFUXCD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|