C19H14N4O3 — CID 67421086
[3-[[3-(4-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamic acid (PubChem CID 67421086) has the molecular formula C19H14N4O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is [3-[[3-(4-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamic acid.
| Compound Name | [3-[[3-(4-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 67421086 |
| Molecular Formula | C19H14N4O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [3-[[3-(4-cyanophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]carbamic acid |
| SMILES | N#Cc1ccc(-c2ccc(=O)n(Cc3cccc(NC(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C19H14N4O3/c20-11-13-4-6-15(7-5-13)17-8-9-18(24)23(22-17)12-14-2-1-3-16(10-14)21-19(25)26/h1-10,21H,12H2,(H,25,26) |
| InChIKey | JGWYESPAMGSGSF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |