C27H33N5O4 — CID 59406722
ethyl N-[3-[[3-[4-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate (PubChem CID 59406722) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is ethyl N-[3-[[3-[4-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[3-[4-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 59406722 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | ethyl N-[3-[[3-[4-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]phenyl]-6-oxopyridazin-1-yl]methyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(Cn2nc(-c3ccc(CC(=O)NCCCN(C)C)cc3)ccc2=O)c1 |
| InChI | InChI=1S/C27H33N5O4/c1-4-36-27(35)29-23-8-5-7-21(17-23)19-32-26(34)14-13-24(30-32)22-11-9-20(10-12-22)18-25(33)28-15-6-16-31(2)3/h5,7-14,17H,4,6,15-16,18-19H2,1-3H3,(H,28,33)(H,29,35) |
| InChIKey | MELLKHBQFJELKU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|