C26H28F3N5O2S — CID 25185007
3-(4-methylpiperazin-1-yl)propyl N-[3-[[6-sulfanylidene-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamate (PubChem CID 25185007) has the molecular formula C26H28F3N5O2S and a molecular weight of 531.60 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)propyl N-[3-[[6-sulfanylidene-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamate.
| Compound Name | 3-(4-methylpiperazin-1-yl)propyl N-[3-[[6-sulfanylidene-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 25185007 |
| Molecular Formula | C26H28F3N5O2S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)propyl N-[3-[[6-sulfanylidene-3-(3,4,5-trifluorophenyl)pyridazin-1-yl]methyl]phenyl]carbamate |
| SMILES | CN1CCN(CCCOC(=O)Nc2cccc(Cn3nc(-c4cc(F)c(F)c(F)c4)ccc3=S)c2)CC1 |
| InChI | InChI=1S/C26H28F3N5O2S/c1-32-9-11-33(12-10-32)8-3-13-36-26(35)30-20-5-2-4-18(14-20)17-34-24(37)7-6-23(31-34)19-15-21(27)25(29)22(28)16-19/h2,4-7,14-16H,3,8-13,17H2,1H3,(H,30,35) |
| InChIKey | KZKRIPSFDGDWPM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|