C24H30N4O4 — CID 25123771
3-(4-methylpiperazin-1-yl)propyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate (PubChem CID 25123771) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)propyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate.
| Compound Name | 3-(4-methylpiperazin-1-yl)propyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 25123771 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)propyl N-[3-[(6-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]carbamate |
| SMILES | Cc1ccc2c(c1)oc(=O)n2Cc1cccc(NC(=O)OCCCN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C24H30N4O4/c1-18-7-8-21-22(15-18)32-24(30)28(21)17-19-5-3-6-20(16-19)25-23(29)31-14-4-9-27-12-10-26(2)11-13-27/h3,5-8,15-16H,4,9-14,17H2,1-2H3,(H,25,29) |
| InChIKey | JSHDYOANPQQDHS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|