C26H33N3O5 — CID 58486047
3-(4-methylpiperazin-1-yl)propyl 2-[3-[[5-(1-hydroxyethyl)-2-oxo-1,3-benzoxazol-3-yl]methyl]phenyl]acetate (PubChem CID 58486047) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)propyl 2-[3-[[5-(1-hydroxyethyl)-2-oxo-1,3-benzoxazol-3-yl]methyl]phenyl]acetate.
| Compound Name | 3-(4-methylpiperazin-1-yl)propyl 2-[3-[[5-(1-hydroxyethyl)-2-oxo-1,3-benzoxazol-3-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 58486047 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)propyl 2-[3-[[5-(1-hydroxyethyl)-2-oxo-1,3-benzoxazol-3-yl]methyl]phenyl]acetate |
| SMILES | CC(O)c1ccc2oc(=O)n(Cc3cccc(CC(=O)OCCCN4CCN(C)CC4)c3)c2c1 |
| InChI | InChI=1S/C26H33N3O5/c1-19(30)22-7-8-24-23(17-22)29(26(32)34-24)18-21-6-3-5-20(15-21)16-25(31)33-14-4-9-28-12-10-27(2)11-13-28/h3,5-8,15,17,19,30H,4,9-14,16,18H2,1-2H3 |
| InChIKey | NNBMLLGDTNEECA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|