C14H20F3NO — CID 167467873
(3Z)-4-[4-methyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]hexa-1,3,5-trien-3-ol (PubChem CID 167467873) has the molecular formula C14H20F3NO and a molecular weight of 275.31 g/mol. Its IUPAC name is (3Z)-4-[4-methyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]hexa-1,3,5-trien-3-ol.
| Compound Name | (3Z)-4-[4-methyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]hexa-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 167467873 |
| Molecular Formula | C14H20F3NO |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (3Z)-4-[4-methyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]hexa-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C(\C=C)C1(C)CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H20F3NO/c1-4-11(12(19)5-2)13(3)6-8-18(9-7-13)10-14(15,16)17/h4-5,19H,1-2,6-10H2,3H3/b12-11- |
| InChIKey | IQKBFSAGSLKEEJ-QXMHVHEDSA-N |
| XLogP | 3.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|