C16H25NO — CID 144515618
(3Z,5Z)-3-(4-ethyl-1-methylpiperidin-4-yl)octa-1,3,5,7-tetraen-4-ol (PubChem CID 144515618) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (3Z,5Z)-3-(4-ethyl-1-methylpiperidin-4-yl)octa-1,3,5,7-tetraen-4-ol.
| Compound Name | (3Z,5Z)-3-(4-ethyl-1-methylpiperidin-4-yl)octa-1,3,5,7-tetraen-4-ol |
|---|---|
| PubChem CID | 144515618 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (3Z,5Z)-3-(4-ethyl-1-methylpiperidin-4-yl)octa-1,3,5,7-tetraen-4-ol |
| SMILES | C=C/C=C\C(O)=C(/C=C)C1(CC)CCN(C)CC1 |
| InChI | InChI=1S/C16H25NO/c1-5-8-9-15(18)14(6-2)16(7-3)10-12-17(4)13-11-16/h5-6,8-9,18H,1-2,7,10-13H2,3-4H3/b9-8-,15-14- |
| InChIKey | JCZJCQJSXVCPKU-FMUMETBJSA-N |
| XLogP | 3.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|