C22H23F3N2O2 — CID 167467992
methylcyclobutane;N-[5-[[4-(trifluoromethyl)phenyl]methoxy]-1H-indol-3-yl]formamide (PubChem CID 167467992) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is methylcyclobutane;N-[5-[[4-(trifluoromethyl)phenyl]methoxy]-1H-indol-3-yl]formamide.
| Compound Name | methylcyclobutane;N-[5-[[4-(trifluoromethyl)phenyl]methoxy]-1H-indol-3-yl]formamide |
|---|---|
| PubChem CID | 167467992 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | methylcyclobutane;N-[5-[[4-(trifluoromethyl)phenyl]methoxy]-1H-indol-3-yl]formamide |
| SMILES | CC1CCC1.O=CNc1c[nH]c2ccc(OCc3ccc(C(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C17H13F3N2O2.C5H10/c18-17(19,20)12-3-1-11(2-4-12)9-24-13-5-6-15-14(7-13)16(8-21-15)22-10-23;1-5-3-2-4-5/h1-8,10,21H,9H2,(H,22,23);5H,2-4H2,1H3 |
| InChIKey | MQEMGVSMKACBBL-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|