C35H38F3N5O4 — CID 167468868
1-[7-[8-ethyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepan-4-one (PubChem CID 167468868) has the molecular formula C35H38F3N5O4 and a molecular weight of 649.71 g/mol. Its IUPAC name is 1-[7-[8-ethyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepan-4-one.
| Compound Name | 1-[7-[8-ethyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepan-4-one |
|---|---|
| PubChem CID | 167468868 |
| Molecular Formula | C35H38F3N5O4 |
| Molecular Weight | 649.71 g/mol |
| Exact Mass | 649.29 |
| IUPAC Name | 1-[7-[8-ethyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]azepan-4-one |
| SMILES | CCc1c(F)ccc2cc(OCOC)cc(-c3ncc4c(N5CCCC(=O)CC5)nc(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C35H38F3N5O4/c1-3-25-28(37)8-7-21-14-24(47-20-45-2)15-26(29(21)25)31-30(38)32-27(17-39-31)33(42-11-4-6-23(44)9-13-42)41-34(40-32)46-19-35-10-5-12-43(35)18-22(36)16-35/h7-8,14-15,17,22H,3-6,9-13,16,18-20H2,1-2H3/t22-,35+/m1/s1 |
| InChIKey | QYJCWWNFFNBXTI-DGOBPVDHSA-N |
| XLogP | 6.18 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.71 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|