C34H38F3N5O4 — CID 167468906
1-[7-[8-ethyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol (PubChem CID 167468906) has the molecular formula C34H38F3N5O4 and a molecular weight of 637.70 g/mol. Its IUPAC name is 1-[7-[8-ethyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol.
| Compound Name | 1-[7-[8-ethyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 167468906 |
| Molecular Formula | C34H38F3N5O4 |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | 1-[7-[8-ethyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol |
| SMILES | CCc1c(F)ccc2cc(OCOC)cc(-c3ncc4c(N5CCCC(O)C5)nc(OC[C@]56CCCN5C[C@@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C34H38F3N5O4/c1-3-24-27(36)8-7-20-12-23(46-19-44-2)13-25(28(20)24)30-29(37)31-26(15-38-30)32(41-10-4-6-22(43)17-41)40-33(39-31)45-18-34-9-5-11-42(34)16-21(35)14-34/h7-8,12-13,15,21-22,43H,3-6,9-11,14,16-19H2,1-2H3/t21-,22?,34+/m0/s1 |
| InChIKey | ICMNTRFKLMIFBS-CLPDODKISA-N |
| XLogP | 5.58 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|