About CID 167469094
CID 167469094 (PubChem CID 167469094) has the molecular formula C12H13B3N2
and a molecular weight of 217.69 g/mol.
Molecular Properties
| Compound Name | CID 167469094 |
| PubChem CID | 167469094 |
| Molecular Formula | C12H13B3N2 |
| Molecular Weight | 217.69 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | — |
| SMILES | [B]C(C)NC([B])C([B])c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H13B3N2/c1-7(13)17-12(15)11(14)9-6-16-10-5-3-2-4-8(9)10/h2-7,11-12,16-17H,1H3 |
| InChIKey | CCOYFLDCXBRGGB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.69 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167469094 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167469094?
The IUPAC name of CID 167469094 (CID 167469094) is not available.
What is the SMILES notation for CID 167469094?
The canonical SMILES for CID 167469094 is [B]C(C)NC([B])C([B])c1c[nH]c2ccccc12.
What is the InChIKey of CID 167469094?
The InChIKey is CCOYFLDCXBRGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13B3N2/c1-7(13)17-12(15)11(14)9-6-16-10-5-3-2-4-8(9)10/h2-7,11-12,16-17H,1H3.
What are the key properties of CID 167469094?
CID 167469094 has a molecular weight of 217.69 g/mol, XLogP of 0.98, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167469094 is sourced from PubChem (CID 167469094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).