C15H22N2 — CID 124566723
(3R)-3-(1H-indol-3-yl)-N,4-dimethylpentan-1-amine (PubChem CID 124566723) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is (3R)-3-(1H-indol-3-yl)-N,4-dimethylpentan-1-amine.
| Compound Name | (3R)-3-(1H-indol-3-yl)-N,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 124566723 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (3R)-3-(1H-indol-3-yl)-N,4-dimethylpentan-1-amine |
| SMILES | CNCC[C@@H](c1c[nH]c2ccccc12)C(C)C |
| InChI | InChI=1S/C15H22N2/c1-11(2)12(8-9-16-3)14-10-17-15-7-5-4-6-13(14)15/h4-7,10-12,16-17H,8-9H2,1-3H3/t12-/m1/s1 |
| InChIKey | KWMHBKWETCPHTG-GFCCVEGCSA-N |
| XLogP | 3.52 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |