C22H27ClN2O5S — CID 167470417
tert-butyl 4-chloro-3-(formyloxymethoxy)-5-[3-(piperidin-4-ylamino)phenyl]thiophene-2-carboxylate (PubChem CID 167470417) has the molecular formula C22H27ClN2O5S and a molecular weight of 466.99 g/mol. Its IUPAC name is tert-butyl 4-chloro-3-(formyloxymethoxy)-5-[3-(piperidin-4-ylamino)phenyl]thiophene-2-carboxylate.
| Compound Name | tert-butyl 4-chloro-3-(formyloxymethoxy)-5-[3-(piperidin-4-ylamino)phenyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 167470417 |
| Molecular Formula | C22H27ClN2O5S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | tert-butyl 4-chloro-3-(formyloxymethoxy)-5-[3-(piperidin-4-ylamino)phenyl]thiophene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1sc(-c2cccc(NC3CCNCC3)c2)c(Cl)c1OCOC=O |
| InChI | InChI=1S/C22H27ClN2O5S/c1-22(2,3)30-21(27)20-18(29-13-28-12-26)17(23)19(31-20)14-5-4-6-16(11-14)25-15-7-9-24-10-8-15/h4-6,11-12,15,24-25H,7-10,13H2,1-3H3 |
| InChIKey | POBWFRGMZUSPPE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|