C29H34ClN3O5S2 — CID 167469855
2-[5-[3-[[1-[(3-aminophenyl)methylsulfanyl]piperidin-4-yl]amino]phenyl]-4-chloro-2-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-3-yl]oxyacetic acid (PubChem CID 167469855) has the molecular formula C29H34ClN3O5S2 and a molecular weight of 604.19 g/mol. Its IUPAC name is 2-[5-[3-[[1-[(3-aminophenyl)methylsulfanyl]piperidin-4-yl]amino]phenyl]-4-chloro-2-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-3-yl]oxyacetic acid.
| Compound Name | 2-[5-[3-[[1-[(3-aminophenyl)methylsulfanyl]piperidin-4-yl]amino]phenyl]-4-chloro-2-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 167469855 |
| Molecular Formula | C29H34ClN3O5S2 |
| Molecular Weight | 604.19 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | 2-[5-[3-[[1-[(3-aminophenyl)methylsulfanyl]piperidin-4-yl]amino]phenyl]-4-chloro-2-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-3-yl]oxyacetic acid |
| SMILES | CC(C)(C)OC(=O)c1sc(-c2cccc(NC3CCN(SCc4cccc(N)c4)CC3)c2)c(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C29H34ClN3O5S2/c1-29(2,3)38-28(36)27-25(37-16-23(34)35)24(30)26(40-27)19-7-5-9-22(15-19)32-21-10-12-33(13-11-21)39-17-18-6-4-8-20(31)14-18/h4-9,14-15,21,32H,10-13,16-17,31H2,1-3H3,(H,34,35) |
| InChIKey | TZXKWYNKRWYMKG-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.19 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|