C28H34ClN3O5S2 — CID 167471646
5-[3-[[(4S)-1-[(3-aminophenyl)methylsulfanyl]-2,2-dimethylpiperidin-4-yl]amino]phenyl]-4-chloro-3-ethoxythiophene-2-carboxylic acid;formic acid (PubChem CID 167471646) has the molecular formula C28H34ClN3O5S2 and a molecular weight of 592.18 g/mol. Its IUPAC name is 5-[3-[[(4S)-1-[(3-aminophenyl)methylsulfanyl]-2,2-dimethylpiperidin-4-yl]amino]phenyl]-4-chloro-3-ethoxythiophene-2-carboxylic acid;formic acid.
| Compound Name | 5-[3-[[(4S)-1-[(3-aminophenyl)methylsulfanyl]-2,2-dimethylpiperidin-4-yl]amino]phenyl]-4-chloro-3-ethoxythiophene-2-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 167471646 |
| Molecular Formula | C28H34ClN3O5S2 |
| Molecular Weight | 592.18 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 5-[3-[[(4S)-1-[(3-aminophenyl)methylsulfanyl]-2,2-dimethylpiperidin-4-yl]amino]phenyl]-4-chloro-3-ethoxythiophene-2-carboxylic acid;formic acid |
| SMILES | CCOc1c(C(=O)O)sc(-c2cccc(N[C@H]3CCN(SCc4cccc(N)c4)C(C)(C)C3)c2)c1Cl.O=CO |
| InChI | InChI=1S/C27H32ClN3O3S2.CH2O2/c1-4-34-23-22(28)24(36-25(23)26(32)33)18-8-6-10-20(14-18)30-21-11-12-31(27(2,3)15-21)35-16-17-7-5-9-19(29)13-17;2-1-3/h5-10,13-14,21,30H,4,11-12,15-16,29H2,1-3H3,(H,32,33);1H,(H,2,3)/t21-;/m0./s1 |
| InChIKey | QCUYIFSXFSJESU-BOXHHOBZSA-N |
| XLogP | 6.95 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.18 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|