C21H30N4O5 — CID 167471026
2-[4-[2-[formyl-[1-(methylamino)-1,5-dioxopentan-2-yl]amino]-N-methylanilino]piperidin-1-yl]acetic acid (PubChem CID 167471026) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[4-[2-[formyl-[1-(methylamino)-1,5-dioxopentan-2-yl]amino]-N-methylanilino]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[formyl-[1-(methylamino)-1,5-dioxopentan-2-yl]amino]-N-methylanilino]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 167471026 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-[4-[2-[formyl-[1-(methylamino)-1,5-dioxopentan-2-yl]amino]-N-methylanilino]piperidin-1-yl]acetic acid |
| SMILES | CNC(=O)C(CCC=O)N(C=O)c1ccccc1N(C)C1CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C21H30N4O5/c1-22-21(30)19(8-5-13-26)25(15-27)18-7-4-3-6-17(18)23(2)16-9-11-24(12-10-16)14-20(28)29/h3-4,6-7,13,15-16,19H,5,8-12,14H2,1-2H3,(H,22,30)(H,28,29) |
| InChIKey | MDGXCVDEZBTTII-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|