C10H10N2O2S — CID 167472743
6-amino-2,7-dimethyl-1,3-benzothiazole-5-carboxylic acid (PubChem CID 167472743) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 6-amino-2,7-dimethyl-1,3-benzothiazole-5-carboxylic acid.
| Compound Name | 6-amino-2,7-dimethyl-1,3-benzothiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 167472743 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 6-amino-2,7-dimethyl-1,3-benzothiazole-5-carboxylic acid |
| SMILES | Cc1nc2cc(C(=O)O)c(N)c(C)c2s1 |
| InChI | InChI=1S/C10H10N2O2S/c1-4-8(11)6(10(13)14)3-7-9(4)15-5(2)12-7/h3H,11H2,1-2H3,(H,13,14) |
| InChIKey | XNDUMMVRCPUDFZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|