About 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol
2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol (PubChem CID 167472768) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol.
Molecular Properties
| Compound Name | 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol |
| PubChem CID | 167472768 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol |
| SMILES | C=COC(C)CC(C)(C)CC(C)(N)CO |
| InChI | InChI=1S/C12H25NO2/c1-6-15-10(2)7-11(3,4)8-12(5,13)9-14/h6,10,14H,1,7-9,13H2,2-5H3 |
| InChIKey | HCFNTIWPCMKZPE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol?
The IUPAC name of 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol (CID 167472768) is 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol.
What is the SMILES notation for 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol?
The canonical SMILES for 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol is C=COC(C)CC(C)(C)CC(C)(N)CO.
What is the InChIKey of 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol?
The InChIKey is HCFNTIWPCMKZPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-6-15-10(2)7-11(3,4)8-12(5,13)9-14/h6,10,14H,1,7-9,13H2,2-5H3.
What are the key properties of 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol?
2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol has a molecular weight of 215.34 g/mol, XLogP of 2.05, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-ethenoxy-2,4,4-trimethylheptan-1-ol is sourced from PubChem (CID 167472768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).