4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride

C11H20FN3O — CID 167474521

IUPAC4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride
SMILESO=C(F)N1CCC(CN2CCNCC2)CC1
InChIInChI=1S/C11H20FN3O/c12-11(16)15-5-1-10(2-6-15)9-14-7-3-13-4-8-14/h10,13H,1-9H2
InChIKeyPZPRCVRQBFAPCT-UHFFFAOYSA-N
MW229.30 g/mol
LogP0.69
Rot. Bonds2

About 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride

4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride (PubChem CID 167474521) has the molecular formula C11H20FN3O and a molecular weight of 229.30 g/mol. Its IUPAC name is 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride.

Molecular Properties

Compound Name4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride
PubChem CID167474521
Molecular FormulaC11H20FN3O
Molecular Weight229.30 g/mol
Exact Mass229.16
IUPAC Name4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride
SMILESO=C(F)N1CCC(CN2CCNCC2)CC1
InChIInChI=1S/C11H20FN3O/c12-11(16)15-5-1-10(2-6-15)9-14-7-3-13-4-8-14/h10,13H,1-9H2
InChIKeyPZPRCVRQBFAPCT-UHFFFAOYSA-N
XLogP0.69
TPSA35.58 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.30
LogP ≤ 50.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride?
The IUPAC name of 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride (CID 167474521) is 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride.
What is the SMILES notation for 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride?
The canonical SMILES for 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride is O=C(F)N1CCC(CN2CCNCC2)CC1.
What is the InChIKey of 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride?
The InChIKey is PZPRCVRQBFAPCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20FN3O/c12-11(16)15-5-1-10(2-6-15)9-14-7-3-13-4-8-14/h10,13H,1-9H2.
What are the key properties of 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride?
4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride has a molecular weight of 229.30 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(piperazin-1-ylmethyl)piperidine-1-carbonyl fluoride is sourced from PubChem (CID 167474521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).