C21H18F3N3S — CID 16747603
N-(4-cyclopropyl-1,1,1-trifluoro-2-phenylbut-3-yn-2-yl)-1-methyl-3-thiophen-2-ylpyrazol-5-amine (PubChem CID 16747603) has the molecular formula C21H18F3N3S and a molecular weight of 401.46 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,1,1-trifluoro-2-phenylbut-3-yn-2-yl)-1-methyl-3-thiophen-2-ylpyrazol-5-amine.
| Compound Name | N-(4-cyclopropyl-1,1,1-trifluoro-2-phenylbut-3-yn-2-yl)-1-methyl-3-thiophen-2-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 16747603 |
| Molecular Formula | C21H18F3N3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-(4-cyclopropyl-1,1,1-trifluoro-2-phenylbut-3-yn-2-yl)-1-methyl-3-thiophen-2-ylpyrazol-5-amine |
| SMILES | Cn1nc(-c2cccs2)cc1NC(C#CC1CC1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H18F3N3S/c1-27-19(14-17(26-27)18-8-5-13-28-18)25-20(21(22,23)24,12-11-15-9-10-15)16-6-3-2-4-7-16/h2-8,13-15,25H,9-10H2,1H3 |
| InChIKey | ZDRXRRPPLAMQIV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|