C16H14F3N3S — CID 58907097
1-methyl-N-(thiophen-3-ylmethyl)-3-[4-(trifluoromethyl)phenyl]pyrazol-5-amine (PubChem CID 58907097) has the molecular formula C16H14F3N3S and a molecular weight of 337.37 g/mol. Its IUPAC name is 1-methyl-N-(thiophen-3-ylmethyl)-3-[4-(trifluoromethyl)phenyl]pyrazol-5-amine.
| Compound Name | 1-methyl-N-(thiophen-3-ylmethyl)-3-[4-(trifluoromethyl)phenyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 58907097 |
| Molecular Formula | C16H14F3N3S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1-methyl-N-(thiophen-3-ylmethyl)-3-[4-(trifluoromethyl)phenyl]pyrazol-5-amine |
| SMILES | Cn1nc(-c2ccc(C(F)(F)F)cc2)cc1NCc1ccsc1 |
| InChI | InChI=1S/C16H14F3N3S/c1-22-15(20-9-11-6-7-23-10-11)8-14(21-22)12-2-4-13(5-3-12)16(17,18)19/h2-8,10,20H,9H2,1H3 |
| InChIKey | XUBIHLOLXVLECJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |