C24H27FN2O3S2 — CID 167476183
2-fluoro-5-methoxy-4-[2-[4-(4-methylcyclohexyl)phenyl]-1,3-thiazol-5-yl]benzoic acid;thiohydroxylamine (PubChem CID 167476183) has the molecular formula C24H27FN2O3S2 and a molecular weight of 474.62 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-4-[2-[4-(4-methylcyclohexyl)phenyl]-1,3-thiazol-5-yl]benzoic acid;thiohydroxylamine.
| Compound Name | 2-fluoro-5-methoxy-4-[2-[4-(4-methylcyclohexyl)phenyl]-1,3-thiazol-5-yl]benzoic acid;thiohydroxylamine |
|---|---|
| PubChem CID | 167476183 |
| Molecular Formula | C24H27FN2O3S2 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-fluoro-5-methoxy-4-[2-[4-(4-methylcyclohexyl)phenyl]-1,3-thiazol-5-yl]benzoic acid;thiohydroxylamine |
| SMILES | COc1cc(C(=O)O)c(F)cc1-c1cnc(-c2ccc(C3CCC(C)CC3)cc2)s1.NS |
| InChI | InChI=1S/C24H24FNO3S.H3NS/c1-14-3-5-15(6-4-14)16-7-9-17(10-8-16)23-26-13-22(30-23)19-11-20(25)18(24(27)28)12-21(19)29-2;1-2/h7-15H,3-6H2,1-2H3,(H,27,28);2H,1H2 |
| InChIKey | HGCHTNBFYOSPHO-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|