C7H9NO — CID 16747700
5,6,7,8-tetrahydropyrrolizin-3-one (PubChem CID 16747700) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 5,6,7,8-tetrahydropyrrolizin-3-one.
| Compound Name | 5,6,7,8-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 16747700 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 5,6,7,8-tetrahydropyrrolizin-3-one |
| SMILES | O=C1C=CC2CCCN12 |
| InChI | InChI=1S/C7H9NO/c9-7-4-3-6-2-1-5-8(6)7/h3-4,6H,1-2,5H2 |
| InChIKey | FVZBHZCORGROSI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |