C25H37F6N5O5 — CID 167481779
N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]formamide;(3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(2,2,2-trifluoroethoxy)butan-1-one;2,2,2-trifluoroacetamide (PubChem CID 167481779) has the molecular formula C25H37F6N5O5 and a molecular weight of 601.59 g/mol. Its IUPAC name is N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]formamide;(3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(2,2,2-trifluoroethoxy)butan-1-one;2,2,2-trifluoroacetamide.
| Compound Name | N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]formamide;(3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(2,2,2-trifluoroethoxy)butan-1-one;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167481779 |
| Molecular Formula | C25H37F6N5O5 |
| Molecular Weight | 601.59 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]formamide;(3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(2,2,2-trifluoroethoxy)butan-1-one;2,2,2-trifluoroacetamide |
| SMILES | CC1(C)CC(CC(C#N)NC=O)C(=O)N1.C[C@H](CC(=O)N1CC2C(C1)C2(C)C)OCC(F)(F)F.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H20F3NO2.C10H15N3O2.C2H2F3NO/c1-8(19-7-13(14,15)16)4-11(18)17-5-9-10(6-17)12(9,2)3;1-10(2)4-7(9(15)13-10)3-8(5-11)12-6-14;3-2(4,5)1(6)7/h8-10H,4-7H2,1-3H3;6-8H,3-4H2,1-2H3,(H,12,14)(H,13,15);(H2,6,7)/t8-,9?,10?;;/m1../s1 |
| InChIKey | JQNMFLSRZSAYDN-NBCNJNCQSA-N |
| XLogP | 2.42 |
| TPSA | 154.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|