C26H37F3N4O4 — CID 167482167
(1R,2S,5S)-N-[(1S,3S)-3-acetyl-1-cyano-5-methylhexyl]-3-[2-cyclobutyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 167482167) has the molecular formula C26H37F3N4O4 and a molecular weight of 526.60 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(1S,3S)-3-acetyl-1-cyano-5-methylhexyl]-3-[2-cyclobutyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(1S,3S)-3-acetyl-1-cyano-5-methylhexyl]-3-[2-cyclobutyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 167482167 |
| Molecular Formula | C26H37F3N4O4 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | (1R,2S,5S)-N-[(1S,3S)-3-acetyl-1-cyano-5-methylhexyl]-3-[2-cyclobutyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(=O)[C@@H](CC(C)C)C[C@@H](C#N)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)C(NC(=O)C(F)(F)F)C1CCC1)C2(C)C |
| InChI | InChI=1S/C26H37F3N4O4/c1-13(2)9-16(14(3)34)10-17(11-30)31-22(35)21-19-18(25(19,4)5)12-33(21)23(36)20(15-7-6-8-15)32-24(37)26(27,28)29/h13,15-21H,6-10,12H2,1-5H3,(H,31,35)(H,32,37)/t16-,17-,18-,19-,20?,21-/m0/s1 |
| InChIKey | OZRLVUZYJGTHFX-CDJMVVTRSA-N |
| XLogP | 2.97 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |