C21H20F4N4O2 — CID 167482691
1-[(3R)-7-fluoro-3-(3-methoxypropyl)-3,4-dihydro-2H-chromen-4-yl]-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]methanimine (PubChem CID 167482691) has the molecular formula C21H20F4N4O2 and a molecular weight of 436.41 g/mol. Its IUPAC name is 1-[(3R)-7-fluoro-3-(3-methoxypropyl)-3,4-dihydro-2H-chromen-4-yl]-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]methanimine.
| Compound Name | 1-[(3R)-7-fluoro-3-(3-methoxypropyl)-3,4-dihydro-2H-chromen-4-yl]-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]methanimine |
|---|---|
| PubChem CID | 167482691 |
| Molecular Formula | C21H20F4N4O2 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 1-[(3R)-7-fluoro-3-(3-methoxypropyl)-3,4-dihydro-2H-chromen-4-yl]-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]methanimine |
| SMILES | COCCC[C@H]1COc2cc(F)ccc2C1/C=N/c1ncnc2[nH]c(C(F)(F)F)cc12 |
| InChI | InChI=1S/C21H20F4N4O2/c1-30-6-2-3-12-10-31-17-7-13(22)4-5-14(17)16(12)9-26-19-15-8-18(21(23,24)25)29-20(15)28-11-27-19/h4-5,7-9,11-12,16H,2-3,6,10H2,1H3,(H,27,28,29)/b26-9+/t12-,16?/m0/s1 |
| InChIKey | MMHKDIOZCOSNGL-ZDOJMDJCSA-N |
| XLogP | 5.04 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|